Organic compounds
Organic compounds are a class of chemical compounds that contain one or more atoms of carbon covalently bonded to each other and atoms of other elements such as hydrogen, oxygen, nitrogen, sulfur, etc.
Compounds or allotropes of carbon that contain only carbon atoms are classified as inorganic compounds and exhibit novel properties.
This class of chemicals has a wide range of applications and includes graphite, diamond, and the more recently discovered graphene, fullerenes, and other carbon nanotubes. In fact, the majority of elements in the periodic table of elements are inorganic compounds.
Filtered Search Results
Mercaptoacetic acid, sodium salt, 98%
CAS: 367-51-1 Molecular Formula: C2H3NaO2S Molecular Weight (g/mol): 114.09 MDL Number: MFCD00043386 InChI Key: GNBVPFITFYNRCN-UHFFFAOYSA-M Synonym: sodium thioglycolate,sodium mercaptoacetate,mercaptoacetic acid sodium salt,mollescal sf,sodium 2-sulfanylacetate,thioglycolate sodium,sodium thioglycollate,mercaptoacetic acid, sodium salt,erhavit d,sodium 2-mercatoethanoate PubChem CID: 23690444 ChEBI: CHEBI:86481 IUPAC Name: sodium;2-sulfanylacetate SMILES: C(C(=O)[O-])S.[Na+]
| PubChem CID | 23690444 |
|---|---|
| CAS | 367-51-1 |
| Molecular Weight (g/mol) | 114.09 |
| ChEBI | CHEBI:86481 |
| MDL Number | MFCD00043386 |
| SMILES | C(C(=O)[O-])S.[Na+] |
| Synonym | sodium thioglycolate,sodium mercaptoacetate,mercaptoacetic acid sodium salt,mollescal sf,sodium 2-sulfanylacetate,thioglycolate sodium,sodium thioglycollate,mercaptoacetic acid, sodium salt,erhavit d,sodium 2-mercatoethanoate |
| IUPAC Name | sodium;2-sulfanylacetate |
| InChI Key | GNBVPFITFYNRCN-UHFFFAOYSA-M |
| Molecular Formula | C2H3NaO2S |
Tris, 99 to 99.5%, MP Biomedicals™
CAS: 77-86-1 Molecular Formula: C4H11NO3 Molecular Weight (g/mol): 121.136 InChI Key: LENZDBCJOHFCAS-UHFFFAOYSA-N Synonym: trometamol,tris,tromethamine,tris hydroxymethyl aminomethane,tham,trisamine,tris buffer,trizma,2-amino-2-hydroxymethyl propane-1,3-diol,tris base PubChem CID: 6503 ChEBI: CHEBI:9754 IUPAC Name: 2-amino-2-(hydroxymethyl)propane-1,3-diol SMILES: C(C(CO)(CO)N)O
| PubChem CID | 6503 |
|---|---|
| CAS | 77-86-1 |
| Molecular Weight (g/mol) | 121.136 |
| ChEBI | CHEBI:9754 |
| SMILES | C(C(CO)(CO)N)O |
| Synonym | trometamol,tris,tromethamine,tris hydroxymethyl aminomethane,tham,trisamine,tris buffer,trizma,2-amino-2-hydroxymethyl propane-1,3-diol,tris base |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol |
| InChI Key | LENZDBCJOHFCAS-UHFFFAOYSA-N |
| Molecular Formula | C4H11NO3 |
Heptafluorobutyric anhydride, 98%
CAS: 336-59-4 Molecular Formula: C8F14O3 Molecular Weight (g/mol): 410.06 MDL Number: MFCD00000432 InChI Key: UFFSXJKVKBQEHC-UHFFFAOYSA-N Synonym: heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization PubChem CID: 67643 ChEBI: CHEBI:39424 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate SMILES: FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 67643 |
|---|---|
| CAS | 336-59-4 |
| Molecular Weight (g/mol) | 410.06 |
| ChEBI | CHEBI:39424 |
| MDL Number | MFCD00000432 |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(=O)OC(=O)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | heptafluorobutyric anhydride,perfluorobutyric anhydride,hfba,heptafluorobutanoic anhydride,2,2,3,3,4,4,4-heptafluorobutanoic anhydride,butanoic acid, heptafluoro-, anhydride,heptafluoro-n-butyric anhydride,heptafluorobutyric acid anhydride,butanoic acid, 2,2,3,3,4,4,4-heptafluoro-, 1,1'-anhydride,heptafluorobutyric anhydride, for gc derivatization |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutanoyl 2,2,3,3,4,4,4-heptafluorobutanoate |
| InChI Key | UFFSXJKVKBQEHC-UHFFFAOYSA-N |
| Molecular Formula | C8F14O3 |
Zirconium(IV) 2,4-pentanedionate, Thermo Scientific Chemicals
CAS: 17501-44-9 Molecular Formula: C20H28O8Zr Molecular Weight (g/mol): 487.66 MDL Number: MFCD00000036 InChI Key: DFPGFWYWSAYLCW-UHFFFAOYSA-N Synonym: 4-hydroxypent-3-en-2-one; zirconium PubChem CID: 50912253 IUPAC Name: 4-hydroxypent-3-en-2-one;zirconium SMILES: [Zr+4].CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O
| PubChem CID | 50912253 |
|---|---|
| CAS | 17501-44-9 |
| Molecular Weight (g/mol) | 487.66 |
| MDL Number | MFCD00000036 |
| SMILES | [Zr+4].CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O.CC(=O)[CH-]C(C)=O |
| Synonym | 4-hydroxypent-3-en-2-one; zirconium |
| IUPAC Name | 4-hydroxypent-3-en-2-one;zirconium |
| InChI Key | DFPGFWYWSAYLCW-UHFFFAOYSA-N |
| Molecular Formula | C20H28O8Zr |
Disodium Dihydrogen Ethylenediaminetetraacetate Dihydrate 99.5+%, TCI America™
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L Synonym: edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs PubChem CID: 44120005 IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 44120005 |
|---|---|
| CAS | 6381-92-6 |
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| Synonym | edta disodium salt,cal-ex decalcifier,buffer solution, ph 10.00,sodium di ethylenediamine tetraacetate dihydrate,ethylenediamine tetraacetic acid, disodium salt dihydrate,ethylenediamine tetraacetic acid, disodium salt, standard solution,sodium di ethylenediamine tetraacetate standard solution,ethylenedinitrilo tetraacetic acid disodium, dihydrate, reagent, acs |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
N,N-Dibutylformamide, 99+%, Thermo Scientific Chemicals
CAS: 761-65-9 Molecular Formula: C9H19NO Molecular Weight (g/mol): 157.26 MDL Number: MFCD00003289 InChI Key: NZMAJUHVSZBJHL-UHFFFAOYSA-N Synonym: dibutylformamide,formamide, n,n-dibutyl,n,n-di-n-butylformamide,formamide, n,n-di-n-butyl,dibutylamid kyseliny mravenci,dibutylamid kyseliny mravenci czech,formamide, dibutyl,n-formyldibutylamine,formamide,n-dibutyl,n,n-di-butylformamide PubChem CID: 12975 IUPAC Name: N,N-dibutylformamide SMILES: CCCCN(CCCC)C=O
| PubChem CID | 12975 |
|---|---|
| CAS | 761-65-9 |
| Molecular Weight (g/mol) | 157.26 |
| MDL Number | MFCD00003289 |
| SMILES | CCCCN(CCCC)C=O |
| Synonym | dibutylformamide,formamide, n,n-dibutyl,n,n-di-n-butylformamide,formamide, n,n-di-n-butyl,dibutylamid kyseliny mravenci,dibutylamid kyseliny mravenci czech,formamide, dibutyl,n-formyldibutylamine,formamide,n-dibutyl,n,n-di-butylformamide |
| IUPAC Name | N,N-dibutylformamide |
| InChI Key | NZMAJUHVSZBJHL-UHFFFAOYSA-N |
| Molecular Formula | C9H19NO |
4-Allyl-1,2-dimethoxybenzene 98.0+%, TCI America™
CAS: 93-15-2 Molecular Formula: C11H14O2 Molecular Weight (g/mol): 178.231 MDL Number: MFCD00008652 InChI Key: ZYEMGPIYFIJGTP-UHFFFAOYSA-N Synonym: methyleugenol,methyl eugenol,4-allyl-1,2-dimethoxybenzene,eugenol methyl ether,4-allylveratrole,o-methyleugenol,eugenyl methyl ether,3,4-dimethoxyallylbenzene,methyl eugenol ether,veratrole methyl ether PubChem CID: 7127 ChEBI: CHEBI:4918 IUPAC Name: 1,2-dimethoxy-4-prop-2-enylbenzene SMILES: COC1=C(C=C(C=C1)CC=C)OC
| PubChem CID | 7127 |
|---|---|
| CAS | 93-15-2 |
| Molecular Weight (g/mol) | 178.231 |
| ChEBI | CHEBI:4918 |
| MDL Number | MFCD00008652 |
| SMILES | COC1=C(C=C(C=C1)CC=C)OC |
| Synonym | methyleugenol,methyl eugenol,4-allyl-1,2-dimethoxybenzene,eugenol methyl ether,4-allylveratrole,o-methyleugenol,eugenyl methyl ether,3,4-dimethoxyallylbenzene,methyl eugenol ether,veratrole methyl ether |
| IUPAC Name | 1,2-dimethoxy-4-prop-2-enylbenzene |
| InChI Key | ZYEMGPIYFIJGTP-UHFFFAOYSA-N |
| Molecular Formula | C11H14O2 |
2,3-Dihydrofuran, 98+%
CAS: 1191-99-7 Molecular Formula: C4H6O Molecular Weight (g/mol): 70.09 MDL Number: MFCD00003205 InChI Key: JKTCBAGSMQIFNL-UHFFFAOYSA-N PubChem CID: 70934 ChEBI: CHEBI:51662 IUPAC Name: 2,3-dihydrofuran SMILES: C1CC=CO1
| PubChem CID | 70934 |
|---|---|
| CAS | 1191-99-7 |
| Molecular Weight (g/mol) | 70.09 |
| ChEBI | CHEBI:51662 |
| MDL Number | MFCD00003205 |
| SMILES | C1CC=CO1 |
| IUPAC Name | 2,3-dihydrofuran |
| InChI Key | JKTCBAGSMQIFNL-UHFFFAOYSA-N |
| Molecular Formula | C4H6O |
3-Benzoyl-1,1,1-trifluoroacetone, 98+%
CAS: 326-06-7 Molecular Formula: C10H7F3O2 Molecular Weight (g/mol): 216.16 MDL Number: MFCD00000425 InChI Key: VVXLFFIFNVKFBD-UHFFFAOYSA-N Synonym: benzoyl-1,1,1-trifluoroacetone,benzoyltrifluoroacetone,4,4,4-trifluoro-1-phenyl-1,3-butanedione,benzoyl trifluoroacetyl methane,3-benzoyl-1,1,1-trifluoroacetone,1,3-butanedione, 4,4,4-trifluoro-1-phenyl,4,4,4-trifluoro-1-phenyl-butane-1,3-dione,1-benzoyl-3,3,3-trifluoroacetone,.omega.-trifluoroacetyl acetophenone,1-benzoyl-3,3,3-trifluoro-2-propanone PubChem CID: 67589 IUPAC Name: 4,4,4-trifluoro-1-phenylbutane-1,3-dione SMILES: FC(F)(F)C(=O)CC(=O)C1=CC=CC=C1
| PubChem CID | 67589 |
|---|---|
| CAS | 326-06-7 |
| Molecular Weight (g/mol) | 216.16 |
| MDL Number | MFCD00000425 |
| SMILES | FC(F)(F)C(=O)CC(=O)C1=CC=CC=C1 |
| Synonym | benzoyl-1,1,1-trifluoroacetone,benzoyltrifluoroacetone,4,4,4-trifluoro-1-phenyl-1,3-butanedione,benzoyl trifluoroacetyl methane,3-benzoyl-1,1,1-trifluoroacetone,1,3-butanedione, 4,4,4-trifluoro-1-phenyl,4,4,4-trifluoro-1-phenyl-butane-1,3-dione,1-benzoyl-3,3,3-trifluoroacetone,.omega.-trifluoroacetyl acetophenone,1-benzoyl-3,3,3-trifluoro-2-propanone |
| IUPAC Name | 4,4,4-trifluoro-1-phenylbutane-1,3-dione |
| InChI Key | VVXLFFIFNVKFBD-UHFFFAOYSA-N |
| Molecular Formula | C10H7F3O2 |
1,5-Dichloro-2,4-dinitrobenzene, 97%
CAS: 3698-83-7 Molecular Formula: C6H2Cl2N2O4 Molecular Weight (g/mol): 236.992 MDL Number: MFCD00024186 InChI Key: ZPXDNSYFDIHPOJ-UHFFFAOYSA-N Synonym: 1,3-dichloro-4,6-dinitrobenzene,benzene, 1,5-dichloro-2,4-dinitro,2,4-dichloro-1,5-dinitrobenzene,4,6-dichloro-1,3-dinitrobenzene,unii-6enc7c8zr0,6enc7c8zr0,1,5-dichloro-2,4-dinitro-benzene,1,3,-dichloro-4,6-dinitrobenzene,1,5-dichlor-2,4-dinitrobenzol,2,5-dinitrobenzene PubChem CID: 77286 IUPAC Name: 1,5-dichloro-2,4-dinitrobenzene SMILES: C1=C(C(=CC(=C1[N+](=O)[O-])Cl)Cl)[N+](=O)[O-]
| PubChem CID | 77286 |
|---|---|
| CAS | 3698-83-7 |
| Molecular Weight (g/mol) | 236.992 |
| MDL Number | MFCD00024186 |
| SMILES | C1=C(C(=CC(=C1[N+](=O)[O-])Cl)Cl)[N+](=O)[O-] |
| Synonym | 1,3-dichloro-4,6-dinitrobenzene,benzene, 1,5-dichloro-2,4-dinitro,2,4-dichloro-1,5-dinitrobenzene,4,6-dichloro-1,3-dinitrobenzene,unii-6enc7c8zr0,6enc7c8zr0,1,5-dichloro-2,4-dinitro-benzene,1,3,-dichloro-4,6-dinitrobenzene,1,5-dichlor-2,4-dinitrobenzol,2,5-dinitrobenzene |
| IUPAC Name | 1,5-dichloro-2,4-dinitrobenzene |
| InChI Key | ZPXDNSYFDIHPOJ-UHFFFAOYSA-N |
| Molecular Formula | C6H2Cl2N2O4 |
Perfluorodecanoic acid, 97%
CAS: 335-76-2 Molecular Formula: C10HF19O2 Molecular Weight (g/mol): 514.09 MDL Number: MFCD00004175 InChI Key: PCIUEQPBYFRTEM-UHFFFAOYSA-N Synonym: perfluorodecanoic acid,nonadecafluorodecanoic acid,ndfda,pfda,perfluoro-n-decanoic acid,nonadecafluoro-n-decanoic acid,decanoic acid, nonadecafluoro,ccris 4417,decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro,perfluorocapric acid PubChem CID: 9555 ChEBI: CHEBI:35546 IUPAC Name: 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid SMILES: OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
| PubChem CID | 9555 |
|---|---|
| CAS | 335-76-2 |
| Molecular Weight (g/mol) | 514.09 |
| ChEBI | CHEBI:35546 |
| MDL Number | MFCD00004175 |
| SMILES | OC(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Synonym | perfluorodecanoic acid,nonadecafluorodecanoic acid,ndfda,pfda,perfluoro-n-decanoic acid,nonadecafluoro-n-decanoic acid,decanoic acid, nonadecafluoro,ccris 4417,decanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluoro,perfluorocapric acid |
| IUPAC Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecanoic acid |
| InChI Key | PCIUEQPBYFRTEM-UHFFFAOYSA-N |
| Molecular Formula | C10HF19O2 |
4-(Aminomethyl)benzoic acid, 99%
CAS: 56-91-7 Molecular Formula: C8H9NO2 Molecular Weight (g/mol): 151.17 MDL Number: MFCD00010203 InChI Key: QCTBMLYLENLHLA-UHFFFAOYSA-N Synonym: 4-aminomethyl benzoic acid,4-carboxybenzylamine,pamba,styptopur,gumbix,p-aminomethylbenzoic acid,aminomethylbenzoic acid,benzoic acid, 4-aminomethyl,benzylamine-4-carboxylic acid,alpha-amino-p-toluic acid PubChem CID: 65526 IUPAC Name: 4-(aminomethyl)benzoic acid SMILES: C1=CC(=CC=C1CN)C(=O)O
| PubChem CID | 65526 |
|---|---|
| CAS | 56-91-7 |
| Molecular Weight (g/mol) | 151.17 |
| MDL Number | MFCD00010203 |
| SMILES | C1=CC(=CC=C1CN)C(=O)O |
| Synonym | 4-aminomethyl benzoic acid,4-carboxybenzylamine,pamba,styptopur,gumbix,p-aminomethylbenzoic acid,aminomethylbenzoic acid,benzoic acid, 4-aminomethyl,benzylamine-4-carboxylic acid,alpha-amino-p-toluic acid |
| IUPAC Name | 4-(aminomethyl)benzoic acid |
| InChI Key | QCTBMLYLENLHLA-UHFFFAOYSA-N |
| Molecular Formula | C8H9NO2 |
Meloxicam
CAS: 71125-38-7 Molecular Formula: C14H13N3O4S2 Molecular Weight (g/mol): 351.40 MDL Number: MFCD00868752 InChI Key: DWMREKMVXIFPFM-ACCUITESSA-N Synonym: meloxicam,mobic,metacam,movalis,meloxicamum,mobicox,mobec,meloxicam mobic,movatec,parocin PubChem CID: 54677470 ChEBI: CHEBI:6741 IUPAC Name: (3E)-3-{hydroxy[(5-methyl-1,3-thiazol-2-yl)amino]methylidene}-2-methyl-3,4-dihydro-2H-1λ⁶,2-benzothiazine-1,1,4-trione SMILES: CN1\C(=C(\O)NC2=NC=C(C)S2)C(=O)C2=CC=CC=C2S1(=O)=O
| PubChem CID | 54677470 |
|---|---|
| CAS | 71125-38-7 |
| Molecular Weight (g/mol) | 351.40 |
| ChEBI | CHEBI:6741 |
| MDL Number | MFCD00868752 |
| SMILES | CN1\C(=C(\O)NC2=NC=C(C)S2)C(=O)C2=CC=CC=C2S1(=O)=O |
| Synonym | meloxicam,mobic,metacam,movalis,meloxicamum,mobicox,mobec,meloxicam mobic,movatec,parocin |
| IUPAC Name | (3E)-3-{hydroxy[(5-methyl-1,3-thiazol-2-yl)amino]methylidene}-2-methyl-3,4-dihydro-2H-1λ⁶,2-benzothiazine-1,1,4-trione |
| InChI Key | DWMREKMVXIFPFM-ACCUITESSA-N |
| Molecular Formula | C14H13N3O4S2 |
Benzylamine 99.0+%, TCI America™
CAS: 100-46-9 Molecular Formula: C7H9N Molecular Weight (g/mol): 107.156 MDL Number: MFCD00008106 InChI Key: WGQKYBSKWIADBV-UHFFFAOYSA-N Synonym: benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine PubChem CID: 7504 ChEBI: CHEBI:40538 IUPAC Name: phenylmethanamine SMILES: C1=CC=C(C=C1)CN
| PubChem CID | 7504 |
|---|---|
| CAS | 100-46-9 |
| Molecular Weight (g/mol) | 107.156 |
| ChEBI | CHEBI:40538 |
| MDL Number | MFCD00008106 |
| SMILES | C1=CC=C(C=C1)CN |
| Synonym | benzylamine,benzenemethanamine,monobenzylamine,alpha-aminotoluene,phenylmethyl amine,aminomethyl benzene,1-phenylmethanamine,moringine,n-benzylamine,phenylmethylamine |
| IUPAC Name | phenylmethanamine |
| InChI Key | WGQKYBSKWIADBV-UHFFFAOYSA-N |
| Molecular Formula | C7H9N |
Polysorbate 60
CAS: 9005-67-8 Molecular Formula: (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC24H46O6 Molecular Weight (g/mol): 522.68 MDL Number: MFCD01780110 InChI Key: DEKFZWMENCCOFU-UHFFFAOYNA-N Synonym: Polyoxyethylene sorbitan monostearate IUPAC Name: 2-{2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy}ethyl dodecanoate SMILES: CCCCCCCCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO
| CAS | 9005-67-8 |
|---|---|
| Molecular Weight (g/mol) | 522.68 |
| MDL Number | MFCD01780110 |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCCOCC(OCCO)C1OCC(OCCO)C1OCCO |
| Synonym | Polyoxyethylene sorbitan monostearate |
| IUPAC Name | 2-{2-[3,4-bis(2-hydroxyethoxy)oxolan-2-yl]-2-(2-hydroxyethoxy)ethoxy}ethyl dodecanoate |
| InChI Key | DEKFZWMENCCOFU-UHFFFAOYNA-N |
| Molecular Formula | (C2H4O)y(C2H4O)w(C2H4O)x(C2H4O)zC24H46O6 |